OpenMol/SMol_S2F_270K-MMChat · Datasets at Hugging Face

id int64 0 300k	molecules dict	ground_truth stringlengths 2 23	messages listlengths 3 3
0	{ "selfies": "[C][C][N][Branch1][Ring1][C][C][C][C][C][C][Branch1][C][C][N][C][=C][C][=C][C][Branch1][C][Cl][=C][C][Ring1][#Branch1][=N][C][=C][C][=C][Branch1][Ring1][O][C][C][=C][Ring1][P][Ring1][Branch2]", "smiles": "CCN(CC)CCCC(C)Nc1c2ccc(Cl)cc2nc2ccc(OC)cc12" }	C23H30ClN3O	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Can you tell me the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C23H30ClN3O", "role": "assistant" } ]
1	{ "selfies": "[N][O][C][C][=Branch1][C][=O][O]", "smiles": "NOCC(=O)O" }	C2H5NO3	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please provide the molecular formula for <molecule_2d> .", "role": "user" }, { "content": "C2H5NO3", "role": "assistant" } ]
2	{ "selfies": "[C][N][C][C][C][C][Ring1][Branch1][C][=C][C][=C][N+1][Branch1][C][C][=C][Ring1][#Branch1]", "smiles": "CN1CCCC1c1ccc[n+](C)c1" }	C11H17N2+	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "<molecule_2d> is the representation of a molecule. What is its molecular formula?", "role": "user" }, { "content": "C11H17N2+", "role": "assistant" } ]
3	{ "selfies": "[C][C][Branch1][C][C][=C][C][C][C][Branch1][C][C][=C][C][C][C][Branch1][C][C][=C][C][C][C][Branch1][C][C][=C][C][C][C][Branch1][C][C][=C][C][C][C][Branch1][C][C][=C][C][C][C][Branch1][C][C][=C][C][C][C][Branch1][C][C][=C][C][O]", "smiles": "CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCO" }	C40H66O	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Can you tell me the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C40H66O", "role": "assistant" } ]
4	{ "selfies": "[C][C][C][C][C][C][C][C][C][C][C][C][Branch1][C][O][C][C][=Branch1][C][=O][O][C][C][Branch1][C][N][C][Branch2][Ring2][N][O][P][=Branch1][C][=O][Branch1][C][O][O][P][=Branch1][C][=O][Branch1][C][O][O][C][C][O][C][Branch1][=N][N][C][=C][C][=Branch1][C][=O][NH1][C][Ring1][#Branch1][=O][C][Branch1][C][O][C][Ring1][=C][O][O][C][Branch1][Ring1][C][O][C][Ring2][Ring2][C][O]", "smiles": "CCCCCCCCCCCC(O)CC(=O)OC1C(N)C(OP(=O)(O)OP(=O)(O)OCC2OC(n3ccc(=O)[nH]c3=O)C(O)C2O)OC(CO)C1O" }	C29H51N3O18P2	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the formula of the molecule <molecule_2d> ?", "role": "user" }, { "content": "C29H51N3O18P2", "role": "assistant" } ]
5	{ "selfies": "[C][C][N][Branch1][Ring1][C][C][C][C][C][C][N][C][=N][C][=C][C][=C][Branch1][P][C][=C][C][Branch1][Ring1][O][C][=C][C][Branch1][Ring1][O][C][=C][Ring1][#Branch2][C][Branch1][#C][N][C][=Branch1][C][=O][N][C][Branch1][C][C][Branch1][C][C][C][=N][C][Ring2][Ring1][Branch2][=N][Ring2][Ring1][N]", "smiles": "CCN(CC)CCCCNc1ncc2cc(-c3cc(OC)cc(OC)c3)c(NC(=O)NC(C)(C)C)nc2n1" }	C28H41N7O3	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C28H41N7O3", "role": "assistant" } ]
6	{ "selfies": "[C][C][=C][C][=C][C][=C][Ring1][=Branch1][N][C][Branch1][Ring1][C][F][=N][C][=C][C][=C][Branch1][C][N][C][=C][Ring1][#Branch1][C][Ring1][=N][=O]", "smiles": "Cc1ccccc1-n1c(CF)nc2ccc(N)cc2c1=O" }	C16H14FN3O	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please provide the molecular formula for <molecule_2d> .", "role": "user" }, { "content": "C16H14FN3O", "role": "assistant" } ]
7	{ "selfies": "[C][C][=C][Branch1][C][C][C][=C][C][=C][Branch1][C][C][C][=C][C][=C][Branch1][C][C][C][C][C][C][Ring1][#Branch1][Branch1][C][C][C]", "smiles": "CC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C" }	C20H30	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please write the molecular formula of the molecule <molecule_2d> .", "role": "user" }, { "content": "C20H30", "role": "assistant" } ]
8	{ "selfies": "[C][O][C][=Branch1][C][=O][C][C][S][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][N][Ring2][Ring1][Ring1][Ring1][S]", "smiles": "COC(=O)C1CSC2(c3ccccc3)c3ccccc3C(=O)N12" }	C18H15NO3S	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "<molecule_2d> is the representation of a molecule. What is its molecular formula?", "role": "user" }, { "content": "C18H15NO3S", "role": "assistant" } ]
9	{ "selfies": "[C][C][C][Branch1][C][C][C][N][C][=Branch1][C][=O][C][Branch2][Ring1][C][C][=C][N][Branch1][Ring1][O][C][C][=C][C][=C][C][=C][Ring1][O][Ring1][=Branch1][N][C][=Branch1][C][=O][C][Branch1][N][C][C][C][C][C][C][=Branch1][C][=O][O][C][N][C][=Branch1][C][=O][C][C][C][C][C][N][Ring1][=Branch1][C][Ring2][Ring2][#Branch1][=O]", "smiles": "CCC(C)C1NC(=O)C(c2cn(OC)c3ccccc23)NC(=O)C(CCCCCC(=O)OC)NC(=O)C2CCCCN2C1=O" }	C32H45N5O7	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Considering the code <molecule_2d>, can you determine the corresponding molecular formula?", "role": "user" }, { "content": "C32H45N5O7", "role": "assistant" } ]
10	{ "selfies": "[O][=C][Branch1][N][N][N][C][S][=Branch1][C][=O][=Branch1][C][=O][O][C][=C][C][=N][C][=C][Ring1][=Branch1]", "smiles": "O=C(NNCS(=O)(=O)O)c1ccncc1" }	C7H9N3O4S	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula for the molecule denoted by <molecule_2d> ?", "role": "user" }, { "content": "C7H9N3O4S", "role": "assistant" } ]
11	{ "selfies": "[C][#C][C][O][S][=Branch1][C][=O][O][C][C][C][C][C][C][Ring1][=Branch1][O][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][C][=C][Ring1][#Branch2]", "smiles": "C#CCOS(=O)OC1CCCCC1Oc1ccc(C(C)(C)C)cc1" }	C19H26O4S	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the formula of the molecule <molecule_2d> ?", "role": "user" }, { "content": "C19H26O4S", "role": "assistant" } ]
12	{ "selfies": "[C][O][C][C][C][C][C][C][Branch1][C][C][C][Branch1][C][O][Branch1][Ring2][O][Ring1][Branch2][C][=Branch1][C][=O][C][=Branch1][C][=O][N][C][C][C][C][C][Ring1][=Branch1][C][=Branch1][C][=O][O][C][Branch2][Ring1][Branch1][C][Branch1][C][C][C][C][C][C][C][Branch1][C][O][C][Branch1][Ring1][O][C][C][Ring1][=Branch2][C][C][=Branch1][C][=O][C][Branch1][C][C][C][=C][Branch1][C][C][C][Branch1][C][O][C][Branch1][Ring1][O][C][C][=Branch1][C][=O][C][Branch1][C][C][C][C][Branch1][C][C][C][=C][C][=C][C][=C][Ring2][Branch1][=C][C]", "smiles": "COC1CC2CCC(C)C(O)(O2)C(=O)C(=O)N2CCCCC2C(=O)OC(C(C)CC2CCC(O)C(OC)C2)CC(=O)C(C)C=C(C)C(O)C(OC)C(=O)C(C)CC(C)C=CC=CC=C1C" }	C51H79NO13	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "I'd like to know the molecular formula of <molecule_2d> . Can you tell me?", "role": "user" }, { "content": "C51H79NO13", "role": "assistant" } ]
14	{ "selfies": "[O][=S][=Branch1][C][=O][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1]", "smiles": "O=S(=O)(c1ccccc1)c1ccc(Cl)cc1" }	C12H9ClO2S	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Convert the representation of a molecule <molecule_2d> into molecular formula.", "role": "user" }, { "content": "C12H9ClO2S", "role": "assistant" } ]
15	{ "selfies": "[C][=C][C][=C][Branch2][Ring1][C][C][=C][N][=C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][O][Ring1][O][C][=C][Ring1][P]", "smiles": "c1ccc(-c2cnc(-c3ccccc3)o2)cc1" }	C15H11NO	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "I'd like to know the molecular formula of <molecule_2d> . Can you tell me?", "role": "user" }, { "content": "C15H11NO", "role": "assistant" } ]
16	{ "selfies": "[C][C][=N][C][=C][C][=C][C][=C][Ring1][=Branch1][S][Ring1][=Branch2]", "smiles": "Cc1nc2ccccc2s1" }	C8H7NS	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Convert the representation of a molecule <molecule_2d> into molecular formula.", "role": "user" }, { "content": "C8H7NS", "role": "assistant" } ]
18	{ "selfies": "[C][O][P][=Branch1][C][=S][Branch1][Ring1][O][C][O][C]", "smiles": "COP(=S)(OC)OC" }	C3H9O3PS	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula for the molecule denoted by <molecule_2d> ?", "role": "user" }, { "content": "C3H9O3PS", "role": "assistant" } ]
19	{ "selfies": "[C][C][Branch1][C][C][N][=C][Branch1][C][N][N][=C][Branch1][C][N][N][Ring1][=Branch2][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1]", "smiles": "CC1(C)N=C(N)N=C(N)N1c1ccc(Cl)cc1" }	C11H14ClN5	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "<molecule_2d> is the representation of a molecule. What is its molecular formula?", "role": "user" }, { "content": "C11H14ClN5", "role": "assistant" } ]
20	{ "selfies": "[O][=C][=N][C][C][Branch1][C][F][Branch1][C][F][C][Branch1][C][F][Branch1][C][F][C][Branch1][C][F][Branch1][C][F][F]", "smiles": "O=C=NCC(F)(F)C(F)(F)C(F)(F)F" }	C5H2F7NO	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Convert the representation of a molecule <molecule_2d> into molecular formula.", "role": "user" }, { "content": "C5H2F7NO", "role": "assistant" } ]
22	{ "selfies": "[C][C][Branch1][C][C][C][S]", "smiles": "CC(C)CS" }	C4H10S	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula for the molecule denoted by <molecule_2d> ?", "role": "user" }, { "content": "C4H10S", "role": "assistant" } ]
23	{ "selfies": "[C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C]", "smiles": "CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC" }	C32H66	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula for the molecule denoted by <molecule_2d> ?", "role": "user" }, { "content": "C32H66", "role": "assistant" } ]
24	{ "selfies": "[C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring1][O]", "smiles": "c1ccc2c(c1)Cc1ccccc1C2" }	C14H12	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please write the molecular formula of the molecule <molecule_2d> .", "role": "user" }, { "content": "C14H12", "role": "assistant" } ]
25	{ "selfies": "[C][C][O][C][=Branch1][C][=O][N][Branch1][Ring1][C][C][N][=O]", "smiles": "CCOC(=O)N(CC)N=O" }	C5H10N2O3	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula for the molecule denoted by <molecule_2d> ?", "role": "user" }, { "content": "C5H10N2O3", "role": "assistant" } ]
26	{ "selfies": "[O][C][=C][C][=C][Branch1][C][Br][C][=C][Ring1][#Branch1][Br]", "smiles": "Oc1ccc(Br)cc1Br" }	C6H4Br2O	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "I'd like to know the molecular formula of <molecule_2d> . Can you tell me?", "role": "user" }, { "content": "C6H4Br2O", "role": "assistant" } ]
27	{ "selfies": "[O][=C][C][=C][NH1][C][=C][Ring1][=Branch1]", "smiles": "O=c1cc[nH]cc1" }	C5H5NO	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Given the representation <molecule_2d>, what would be its molecular formula?", "role": "user" }, { "content": "C5H5NO", "role": "assistant" } ]
28	{ "selfies": "[C][C][=C][C][Branch2][Ring1][Ring1][O][C][=C][Branch1][C][I][C][=C][Branch1][Ring2][C][C][O][C][=C][Ring1][#Branch2][I][=C][C][Branch1][C][C][=C][Ring2][Ring1][Ring1][O]", "smiles": "Cc1cc(Oc2c(I)cc(CCO)cc2I)cc(C)c1O" }	C16H16I2O3	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C16H16I2O3", "role": "assistant" } ]
29	{ "selfies": "[C][C][C][C][O][P][Branch1][Branch1][O][C][Ring1][=Branch1][O][C][Ring1][Branch2]", "smiles": "CCC12COP(OC1)OC2" }	C6H11O3P	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Can you tell me the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C6H11O3P", "role": "assistant" } ]
30	{ "selfies": "[C][C][C][C][C][C][C][C][Branch1][C][Cl][C][C]", "smiles": "CCCCCCCC(Cl)CC" }	C10H21Cl	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please write the molecular formula of the molecule <molecule_2d> .", "role": "user" }, { "content": "C10H21Cl", "role": "assistant" } ]
31	{ "selfies": "[C][N][Branch2][Ring1][Ring2][C][=Branch1][C][=S][O][C][=C][C][=C][C][=C][C][=C][C][Ring1][=Branch1][=C][Ring1][#Branch2][C][=C][C][=C][C][=C][C][=C][C][=C][Ring1][#Branch2][Ring1][=Branch1]", "smiles": "CN(C(=S)Oc1ccc2ccccc2c1)c1cccc2ccccc12" }	C22H17NOS	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Considering the code <molecule_2d>, can you determine the corresponding molecular formula?", "role": "user" }, { "content": "C22H17NOS", "role": "assistant" } ]
32	{ "selfies": "[C][C][C][=C][Branch1][S][C][=Branch1][C][=O][N][N][C][C][=C][C][=C][C][=C][Ring1][=Branch1][O][N][=Ring1][S]", "smiles": "Cc1cc(C(=O)NNCc2ccccc2)on1" }	C12H13N3O2	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Given the representation <molecule_2d>, what would be its molecular formula?", "role": "user" }, { "content": "C12H13N3O2", "role": "assistant" } ]
33	{ "selfies": "[C][Si][Branch1][C][Cl][Branch1][C][Cl][C][C][C][C][#N]", "smiles": "C[Si](Cl)(Cl)CCCC#N" }	C5H9Cl2NSi	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Can you tell me the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C5H9Cl2NSi", "role": "assistant" } ]
34	{ "selfies": "[C][=C][C][=C][Branch2][Ring1][=C][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][N][C][C][O][C][C][Ring1][=Branch1][C][=C][Ring2][Ring1][=Branch2]", "smiles": "c1ccc(C(c2ccccc2)(c2ccccc2)N2CCOCC2)cc1" }	C23H23NO	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "The representation <molecule_2d> represents a specific molecule. Can you reveal its molecular formula?", "role": "user" }, { "content": "C23H23NO", "role": "assistant" } ]
35	{ "selfies": "[C][=C][Branch1][Ring1][C][C][C][C][C][C]", "smiles": "C=C(CC)CCCC" }	C8H16	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C8H16", "role": "assistant" } ]
36	{ "selfies": "[C][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C]", "smiles": "C=CC(=O)OC(C)(C)C" }	C7H12O2	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula for the molecule denoted by <molecule_2d> ?", "role": "user" }, { "content": "C7H12O2", "role": "assistant" } ]
37	{ "selfies": "[N][C][=Branch1][C][=O][C][N][C][=Branch1][C][=O][N][Branch1][#Branch1][C][C][Branch1][C][N][=O][C][=Branch1][C][=O][N][Branch1][#Branch1][C][C][Branch1][C][N][=O][C][Ring1][S][=O]", "smiles": "NC(=O)Cn1c(=O)n(CC(N)=O)c(=O)n(CC(N)=O)c1=O" }	C9H12N6O6	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Convert the representation of a molecule <molecule_2d> into molecular formula.", "role": "user" }, { "content": "C9H12N6O6", "role": "assistant" } ]
38	{ "selfies": "[N][#C][C][=C][Branch1][C][Cl][C][Branch1][C][Cl][=C][Branch1][C][Cl][C][Branch1][Ring1][C][#N][=C][Ring1][O][Cl]", "smiles": "N#Cc1c(Cl)c(Cl)c(Cl)c(C#N)c1Cl" }	C8Cl4N2	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "<molecule_2d> is the representation of a molecule. What is its molecular formula?", "role": "user" }, { "content": "C8Cl4N2", "role": "assistant" } ]
39	{ "selfies": "[C][C][Branch1][Ring1][C][Cl][O][C][=Branch1][C][=O][N][C][=C][C][=C][C][Branch1][C][Cl][=C][Ring1][#Branch1]", "smiles": "CC(CCl)OC(=O)Nc1cccc(Cl)c1" }	C10H11Cl2NO2	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please provide the molecular formula for <molecule_2d> .", "role": "user" }, { "content": "C10H11Cl2NO2", "role": "assistant" } ]
40	{ "selfies": "[N][C][=Branch1][C][=O][N][Hg][C][=C][C][=C][C][=C][Ring1][=Branch1]", "smiles": "NC(=O)N[Hg]c1ccccc1" }	C7H8HgN2O	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Can you give the molecular molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C7H8HgN2O", "role": "assistant" } ]
45	{ "selfies": "[Cl][C][=C][C][=C][Branch2][Ring1][=C][C][=N][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][=N][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][=N][Ring2][Ring1][C][C][=C][Ring2][Ring1][Branch2]", "smiles": "Clc1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc1" }	C21H14ClN3	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Can you give the molecular molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C21H14ClN3", "role": "assistant" } ]
46	{ "selfies": "[N][C][Branch1][N][C][C][N][C][C][C][C][C][C][Ring1][#Branch1][=N][O]", "smiles": "NC(CCN1CCCCCC1)=NO" }	C9H19N3O	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula for the molecule denoted by <molecule_2d> ?", "role": "user" }, { "content": "C9H19N3O", "role": "assistant" } ]
47	{ "selfies": "[C][C][O][C][=C][C][=C][Branch2][Ring1][Branch2][O][C][=N][C][=C][C][=C][C][=C][Ring1][=Branch1][N][Ring1][=Branch2][C][C][N][Branch1][Ring1][C][C][C][C][C][=C][Ring2][Ring1][#Branch1]", "smiles": "CCOc1ccc(Oc2nc3ccccc3n2CCN(CC)CC)cc1" }	C21H27N3O2	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the formula of the molecule <molecule_2d> ?", "role": "user" }, { "content": "C21H27N3O2", "role": "assistant" } ]
49	{ "selfies": "[C][C][=Branch1][C][=O][O][C][=C][C][=C][C][=C][Ring1][=Branch1][Cl]", "smiles": "CC(=O)Oc1ccccc1Cl" }	C8H7ClO2	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please provide the molecular formula for <molecule_2d> .", "role": "user" }, { "content": "C8H7ClO2", "role": "assistant" } ]
50	{ "selfies": "[C][C][Branch2][Ring1][O][C][C][=C][NH1][C][=C][C][=C][Branch1][O][S][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring1][P][Ring1][=C][N][Branch1][C][C][C]", "smiles": "CC(Cc1c[nH]c2ccc(SCc3ccccc3)cc12)N(C)C" }	C20H24N2S	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please write the molecular formula of the molecule <molecule_2d> .", "role": "user" }, { "content": "C20H24N2S", "role": "assistant" } ]
51	{ "selfies": "[C][C][N][Branch1][Ring1][C][C][C][C][N][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Branch1][C][C][C]", "smiles": "CCN(CC)CCN(c1ccccc1)C(C)C" }	C15H26N2	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Convert the representation of a molecule <molecule_2d> into molecular formula.", "role": "user" }, { "content": "C15H26N2", "role": "assistant" } ]
52	{ "selfies": "[C][C][O][C][=Branch1][C][=O][N][Branch1][Ring2][C][C][Cl][N][=O]", "smiles": "CCOC(=O)N(CCCl)N=O" }	C5H9ClN2O3	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Given the representation <molecule_2d>, what would be its molecular formula?", "role": "user" }, { "content": "C5H9ClN2O3", "role": "assistant" } ]
53	{ "selfies": "[Cl][Fe][Cl]", "smiles": "Cl[Fe]Cl" }	Cl2Fe	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the formula of the molecule <molecule_2d> ?", "role": "user" }, { "content": "Cl2Fe", "role": "assistant" } ]
54	{ "selfies": "[C][O][C][=Branch1][C][=O][N][C][=C][C][=C][C][Branch2][Ring1][C][O][C][=Branch1][C][=O][N][C][=C][C][=C][C][Branch1][C][C][=C][Ring1][#Branch1][=C][Ring1][P]", "smiles": "COC(=O)Nc1cccc(OC(=O)Nc2cccc(C)c2)c1" }	C16H16N2O4	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C16H16N2O4", "role": "assistant" } ]
56	{ "selfies": "[O][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][C][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][Ring1][=N][C][=C][C][=C][Branch1][N][O][C][C][N][C][C][C][C][C][Ring1][=Branch1][C][=C][Ring1][#C]", "smiles": "Oc1ccc2c(c1)CCC(c1ccccc1)=C2c1ccc(OCCN2CCCCC2)cc1" }	C29H31NO2	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C29H31NO2", "role": "assistant" } ]
57	{ "selfies": "[C][C][=Branch1][C][=O][C][=C][C][=C][Branch2][Ring1][Branch1][N][C][O][C][Branch1][Ring1][C][O][C][Branch1][C][O][C][Branch1][C][O][C][Ring1][#Branch2][O][C][=C][Ring2][Ring1][C]", "smiles": "CC(=O)c1ccc(NC2OC(CO)C(O)C(O)C2O)cc1" }	C14H19NO6	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C14H19NO6", "role": "assistant" } ]
58	{ "selfies": "[N][#C][C][Branch1][Ring1][C][#N][=C][C][#C][C][=C][C][=C][C][=C][Ring1][=Branch1]", "smiles": "N#CC(C#N)=CC#Cc1ccccc1" }	C12H6N2	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please write the molecular formula of the molecule <molecule_2d> .", "role": "user" }, { "content": "C12H6N2", "role": "assistant" } ]
60	{ "selfies": "[C][=C][C][C][=C][C][=C][Branch1][Branch2][O][C][=Branch1][C][=O][N][C][C][Branch1][Ring1][O][C][=C][Ring1][=N]", "smiles": "C=CCc1ccc(OC(=O)NC)c(OC)c1" }	C12H15NO3	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C12H15NO3", "role": "assistant" } ]
61	{ "selfies": "[C][O][C][=C][C][Branch1][C][N][=C][C][=C][Ring1][#Branch1][O][C][C][C][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1]", "smiles": "COc1cc(N)ccc1OCCCCCc1ccccc1" }	C18H23NO2	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please write the molecular formula of the molecule <molecule_2d> .", "role": "user" }, { "content": "C18H23NO2", "role": "assistant" } ]
62	{ "selfies": "[C][C][Branch1][C][C][C][=Branch1][C][=O][O][C][C][Branch1][C][C][Branch1][C][C][C][Branch2][Ring1][N][O][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Branch1][C][C][C]", "smiles": "CC(C)C(=O)OCC(C)(C)C(OC(=O)c1ccccc1C(=O)OCc1ccccc1)C(C)C" }	C27H34O6	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Can you tell me the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C27H34O6", "role": "assistant" } ]
64	{ "selfies": "[C][C][O][C][C][=C][Branch1][C][O][C][=C][C][=Branch1][Branch1][=C][Ring1][#Branch1][O][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring1][=N][=O]", "smiles": "CCOCc1c(O)cc2c(c1O)C(=O)c1ccccc1C2=O" }	C17H14O5	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Convert the representation of a molecule <molecule_2d> into molecular formula.", "role": "user" }, { "content": "C17H14O5", "role": "assistant" } ]
65	{ "selfies": "[C][O][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][O][C][Branch1][C][C][Branch1][C][C][C][=C][Ring1][=Branch2]", "smiles": "COc1ccc2c(c1)OC(C)(C)C=C2" }	C12H14O2	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the formula of the molecule <molecule_2d> ?", "role": "user" }, { "content": "C12H14O2", "role": "assistant" } ]
66	{ "selfies": "[C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][=Branch1][C][=O][O][C][C]", "smiles": "CCCCCCCCCCCCCCCCCCCC(=O)OCC" }	C22H44O2	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Given the representation <molecule_2d>, what would be its molecular formula?", "role": "user" }, { "content": "C22H44O2", "role": "assistant" } ]
68	{ "selfies": "[C][C][C][C][C][O][C][Branch1][=Branch1][C][Branch1][C][C][C][O][C][Ring1][=Branch2]", "smiles": "CCCC1COC(C(C)C)OC1" }	C10H20O2	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please provide the molecular formula for <molecule_2d> .", "role": "user" }, { "content": "C10H20O2", "role": "assistant" } ]
69	{ "selfies": "[C][S][=Branch1][C][=O][=Branch1][C][=O][O][C][C][O]", "smiles": "CS(=O)(=O)OCCO" }	C3H8O4S	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "The representation <molecule_2d> represents a specific molecule. Can you reveal its molecular formula?", "role": "user" }, { "content": "C3H8O4S", "role": "assistant" } ]
70	{ "selfies": "[C][C][O][C][=Branch1][C][=O][C][Branch1][C][C][Branch1][Branch1][C][C][O][C][C][=Branch1][C][=O][O][C][C]", "smiles": "CCOC(=O)C(C)(CCOC)C(=O)OCC" }	C11H20O5	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please provide the molecular formula for <molecule_2d> .", "role": "user" }, { "content": "C11H20O5", "role": "assistant" } ]
72	{ "selfies": "[C][C][S][C][C][Branch1][C][N][C][=Branch1][C][=O][O]", "smiles": "CCSCC(N)C(=O)O" }	C5H11NO2S	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Can you tell me the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C5H11NO2S", "role": "assistant" } ]
73	{ "selfies": "[C][C][C][C][C][C][C][C][C][=O]", "smiles": "CCCCCCCCC=O" }	C9H18O	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "The representation <molecule_2d> represents a specific molecule. Can you reveal its molecular formula?", "role": "user" }, { "content": "C9H18O", "role": "assistant" } ]
78	{ "selfies": "[C][O][C][=C][C][=C][C][=C][Ring1][=Branch1][N][C][C][N][Branch2][Ring1][N][C][=Branch1][C][=O][C][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][C][Ring2][Ring1][#Branch1]", "smiles": "COc1ccccc1N1CCN(C(=O)CC(c2ccccc2)c2ccc(Cl)cc2)CC1" }	C26H27ClN2O2	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the formula of the molecule <molecule_2d> ?", "role": "user" }, { "content": "C26H27ClN2O2", "role": "assistant" } ]
79	{ "selfies": "[C][N][C][=C][C][=C][C][=C][Branch1][Ring1][O][C][C][Branch1][Ring1][O][C][=C][C][=C][Ring1][=C][Ring1][#Branch2]", "smiles": "CNc1cccc2c(OC)c(OC)ccc12" }	C13H15NO2	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Can you give the molecular molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C13H15NO2", "role": "assistant" } ]
80	{ "selfies": "[C][C][C][C][As][Branch1][#Branch2][S][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1]", "smiles": "CCCC[As](Sc1ccccc1)c1ccccc1" }	C16H19AsS	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please write the molecular formula of the molecule <molecule_2d> .", "role": "user" }, { "content": "C16H19AsS", "role": "assistant" } ]
81	{ "selfies": "[C][C][C][N][Branch1][Ring2][C][C][C][C][=N][C][Branch1][=Branch2][C][Branch1][C][Cl][Branch1][C][Cl][Cl][=N][C][Branch1][=Branch2][C][Branch1][C][Cl][Branch1][C][Cl][Cl][=N][Ring1][=C]", "smiles": "CCCN(CCC)c1nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n1" }	C11H14Cl6N4	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please write the molecular formula of the molecule <molecule_2d> .", "role": "user" }, { "content": "C11H14Cl6N4", "role": "assistant" } ]
82	{ "selfies": "[C][C][C][C][C][=Branch1][C][=O][C][=C][Branch1][C][C][O][C]", "smiles": "CCCCC(=O)C=C(C)OC" }	C9H16O2	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Considering the code <molecule_2d>, can you determine the corresponding molecular formula?", "role": "user" }, { "content": "C9H16O2", "role": "assistant" } ]
83	{ "selfies": "[C][C][N][Branch1][Ring1][C][C][C][=Branch1][C][=O][C][C][Branch1][C][O][C][Branch1][C][Cl][Branch1][C][Cl][Cl]", "smiles": "CCN(CC)C(=O)CC(O)C(Cl)(Cl)Cl" }	C8H14Cl3NO2	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the formula of the molecule <molecule_2d> ?", "role": "user" }, { "content": "C8H14Cl3NO2", "role": "assistant" } ]
85	{ "selfies": "[N-1][=N+1][=C][C][=N][C][Branch1][C][N][=N][C][Branch1][C][N][=N][Ring1][Branch2]", "smiles": "[N-]=[N+]=Cc1nc(N)nc(N)n1" }	C4H5N7	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please write the molecular formula of the molecule <molecule_2d> .", "role": "user" }, { "content": "C4H5N7", "role": "assistant" } ]
86	{ "selfies": "[C][S][C][Branch1][Ring1][S][C][C][=N][C][Branch1][C][C][=N][C][Branch1][=Branch1][C][Branch1][C][Cl][Cl][=N][Ring1][#Branch2]", "smiles": "CSC(SC)c1nc(C)nc(C(Cl)Cl)n1" }	C8H11Cl2N3S2	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "<molecule_2d> is the representation of a molecule. What is its molecular formula?", "role": "user" }, { "content": "C8H11Cl2N3S2", "role": "assistant" } ]
87	{ "selfies": "[O][=C][Branch1][O][C][=C][C][=C][C][=C][C][=C][Ring1][=Branch1][N][C][C][Cl]", "smiles": "O=C(C=Cc1ccccc1)NCCCl" }	C11H12ClNO	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Convert the representation of a molecule <molecule_2d> into molecular formula.", "role": "user" }, { "content": "C11H12ClNO", "role": "assistant" } ]
88	{ "selfies": "[C][C][C][C][O][C][=N][C][Branch1][C][C][=N][C][Branch1][=Branch2][C][Branch1][C][Cl][Branch1][C][Cl][Cl][=N][Ring1][O]", "smiles": "CCCCOc1nc(C)nc(C(Cl)(Cl)Cl)n1" }	C9H12Cl3N3O	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Can you give the molecular molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C9H12Cl3N3O", "role": "assistant" } ]
91	{ "selfies": "[C][=C][Branch1][C][C][C][N][C][C][C][=C][Branch1][C][C][NH1][C][=C][C][=C][Branch1][Ring1][O][C][C][Branch1][C][C][=C][Ring1][=N][Ring1][=Branch2]", "smiles": "C=C(C)CNCCc1c(C)[nH]c2ccc(OC)c(C)c12" }	C17H24N2O	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula for the molecule denoted by <molecule_2d> ?", "role": "user" }, { "content": "C17H24N2O", "role": "assistant" } ]
93	{ "selfies": "[C][O][C][=C][C][Branch1][=C][C][=C][C][=Branch1][C][=O][N][C][C][C][O][Ring1][Branch1][=C][C][Branch1][Ring1][O][C][=C][Ring1][P][O][C]", "smiles": "COc1cc(C=CC(=O)N2CCCO2)cc(OC)c1OC" }	C15H19NO5	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please provide the molecular formula for <molecule_2d> .", "role": "user" }, { "content": "C15H19NO5", "role": "assistant" } ]
94	{ "selfies": "[C][C][=C][C][Branch1][=Branch1][N][Branch1][C][C][C][=C][N][=C][N][=C][Ring1][Branch1][C][N][=C][Branch1][C][N][N][Branch1][C][C][C][Ring2][Ring1][C][=Ring1][#Branch1]", "smiles": "Cc1cc(N(C)C)c2ncnc-2c2nc(N)n(C)c12" }	C13H16N6	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C13H16N6", "role": "assistant" } ]
96	{ "selfies": "[O][=C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][N][Branch1][C][O][C][N][C][C][O][C][C][Ring1][=Branch1]", "smiles": "O=C(c1ccccc1)N(O)CN1CCOCC1" }	C12H16N2O3	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the formula of the molecule <molecule_2d> ?", "role": "user" }, { "content": "C12H16N2O3", "role": "assistant" } ]
97	{ "selfies": "[C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][N][Branch1][C][C][C][Branch1][C][C][C][Ring1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1]", "smiles": "Cc1cccc2c1C(=O)N(C)C(C)C2c1ccccc1" }	C18H19NO	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula for the molecule denoted by <molecule_2d> ?", "role": "user" }, { "content": "C18H19NO", "role": "assistant" } ]
98	{ "selfies": "[C][C][C][Branch1][C][C][C][O][C][=Branch1][C][=O][C][Ring1][#Branch1]", "smiles": "CCC1(C)COC(=O)C1" }	C7H12O2	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please provide the molecular formula for <molecule_2d> .", "role": "user" }, { "content": "C7H12O2", "role": "assistant" } ]
100	{ "selfies": "[C][C][O][C][=Branch1][C][=O][C][Branch1][#Branch2][C][N][C][C][C][C][C][Ring1][=Branch1][Branch1][Branch2][C][=Branch1][C][=O][O][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1]", "smiles": "CCOC(=O)C(CN1CCCCC1)(C(=O)OCC)c1ccccc1" }	C19H27NO4	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Can you give the molecular molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C19H27NO4", "role": "assistant" } ]
102	{ "selfies": "[C][C][Branch1][Ring1][C][=O][=C][C][Branch1][C][C][Branch1][C][C][C]", "smiles": "CC(C=O)=CC(C)(C)C" }	C8H14O	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Convert the representation of a molecule <molecule_2d> into molecular formula.", "role": "user" }, { "content": "C8H14O", "role": "assistant" } ]
104	{ "selfies": "[C][N][Branch1][#Branch2][S][N][C][C][O][C][C][Ring1][=Branch1][C][=Branch1][C][=O][O][C][=C][C][=C][C][=C][Ring1][=Branch1][O][C][Branch1][C][C][Branch1][C][C][C][Ring1][#Branch1]", "smiles": "CN(SN1CCOCC1)C(=O)Oc1cccc2c1OC(C)(C)C2" }	C16H22N2O4S	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "<molecule_2d> is the representation of a molecule. What is its molecular formula?", "role": "user" }, { "content": "C16H22N2O4S", "role": "assistant" } ]
105	{ "selfies": "[C][C][O][C][=Branch1][C][=O][C][=C][Branch1][C][C][C][=C][C][Branch1][Ring1][C][O][=N][NH1][C][=Branch1][C][=O][C][Ring1][=Branch2][=C][Ring1][=C][C]", "smiles": "CCOC(=O)c1c(C)cc2c(CO)n[nH]c(=O)c2c1C" }	C14H16N2O4	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please write the molecular formula of the molecule <molecule_2d> .", "role": "user" }, { "content": "C14H16N2O4", "role": "assistant" } ]
106	{ "selfies": "[C][C][Branch1][C][C][C][=Branch1][C][=O][C][C][C][C][C][=Branch1][C][=O][C][C][C][Ring1][#Branch1][Ring1][=N][C]", "smiles": "CC1(C)C(=O)CCC2CC(=O)CCC21C" }	C13H20O2	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Can you give the molecular molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C13H20O2", "role": "assistant" } ]
107	{ "selfies": "[C][#C][C][O][C][Branch1][C][C][N][C][=C][C][=C][C][=C][C][=C][Ring1][=Branch1][Ring1][=Branch2]", "smiles": "C#CCOC(C)n1ccc2ccccc21" }	C13H13NO	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "<molecule_2d> is the representation of a molecule. What is its molecular formula?", "role": "user" }, { "content": "C13H13NO", "role": "assistant" } ]
108	{ "selfies": "[C][C][=C][C][=C][C][Branch1][N][O][C][=Branch1][C][=O][N][Branch1][C][C][N][=O][=C][Ring1][=N]", "smiles": "Cc1cccc(OC(=O)N(C)N=O)c1" }	C9H10N2O3	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "The representation <molecule_2d> represents a specific molecule. Can you reveal its molecular formula?", "role": "user" }, { "content": "C9H10N2O3", "role": "assistant" } ]
109	{ "selfies": "[C][O][C][=C][C][=C][Branch1][=N][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Branch1][Ring1][O][C][=C][Ring1][S][C][N][C][C][C][C][C][Ring1][=Branch1]", "smiles": "COc1ccc(C(=O)c2ccccc2)c(OC)c1CN1CCCCC1" }	C21H25NO3	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Given the representation <molecule_2d>, what would be its molecular formula?", "role": "user" }, { "content": "C21H25NO3", "role": "assistant" } ]
111	{ "selfies": "[C][C][Branch1][C][C][N][C][C][=Branch1][C][=O][N][C][C][=Branch1][C][=O][N][Branch1][C][C][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][Cl]", "smiles": "CC(C)NCC(=O)NCC(=O)N(C)c1ccc(Cl)cc1C(=O)c1ccccc1Cl" }	C21H23Cl2N3O3	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula for the molecule denoted by <molecule_2d> ?", "role": "user" }, { "content": "C21H23Cl2N3O3", "role": "assistant" } ]
112	{ "selfies": "[C][N][C][C][N][Branch2][Ring1][Branch1][C][=C][Branch1][C][N][C][=Branch1][C][=O][O][C][=C][C][=C][C][=C][Ring1][N][Ring1][=Branch1][C][C][Ring2][Ring1][C]", "smiles": "CN1CCN(c2c(N)c(=O)oc3ccccc23)CC1" }	C14H17N3O2	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Convert the representation of a molecule <molecule_2d> into molecular formula.", "role": "user" }, { "content": "C14H17N3O2", "role": "assistant" } ]
113	{ "selfies": "[O][=C][Branch1][C][O][C][Branch1][C][Cl][Branch1][C][Cl][C][=C][C][=C][C][=C][Ring1][=Branch1]", "smiles": "O=C(O)C(Cl)(Cl)c1ccccc1" }	C8H6Cl2O2	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Can you tell me the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C8H6Cl2O2", "role": "assistant" } ]
114	{ "selfies": "[O][C][=C][C][=C][C][Branch1][C][F][=C][Ring1][#Branch1][C][=N][C][C][N][=C][C][=C][Branch1][C][O][C][=C][C][=C][Ring1][#Branch1][F]", "smiles": "Oc1cccc(F)c1C=NCCN=Cc1c(O)cccc1F" }	C16H14F2N2O2	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C16H14F2N2O2", "role": "assistant" } ]
115	{ "selfies": "[O][=C][Branch1][#Branch2][N][N][=C][S][C][C][S][Ring1][Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1]", "smiles": "O=C(NN=C1SCCS1)c1ccccc1" }	C10H10N2OS2	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please write the molecular formula of the molecule <molecule_2d> .", "role": "user" }, { "content": "C10H10N2OS2", "role": "assistant" } ]
119	{ "selfies": "[C][C][C][C][C][C][O][C][=C][C][=C][Branch2][Ring1][Ring1][N][C][=Branch1][C][=O][O][C][Branch1][C][C][C][N][Branch1][Ring1][C][C][C][C][C][Branch1][C][C][=C][Ring2][Ring1][Ring1]", "smiles": "CCCCCCOc1ccc(NC(=O)OC(C)CN(CC)CC)c(C)c1" }	C21H36N2O3	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Given the representation <molecule_2d>, what would be its molecular formula?", "role": "user" }, { "content": "C21H36N2O3", "role": "assistant" } ]
120	{ "selfies": "[C][N][Branch1][C][C][C][=Branch1][C][=O][O][C][=C][C][=C][Branch1][O][N+1][Branch1][C][C][Branch1][C][C][C][C][O][C][=C][Ring1][N]", "smiles": "CN(C)C(=O)Oc1ccc([N+](C)(C)CCO)cc1" }	C13H21N2O3+	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Can you tell me the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C13H21N2O3+", "role": "assistant" } ]
122	{ "selfies": "[C][C][=Branch1][C][=O][N][Branch1][=Branch1][C][Branch1][C][C][=O][C][Branch1][C][C][Branch1][C][C][C]", "smiles": "CC(=O)N(C(C)=O)C(C)(C)C" }	C8H15NO2	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula for the molecule denoted by <molecule_2d> ?", "role": "user" }, { "content": "C8H15NO2", "role": "assistant" } ]
123	{ "selfies": "[C][N][Branch1][C][C][C][C][C][C][C][C][Branch1][N][C][C][Branch1][Ring2][C][Ring1][=Branch1][C][Ring1][=Branch2][Br][C][Ring1][O]", "smiles": "CN(C)CC12CC3CC(CC(C3)C1Br)C2" }	C13H22BrN	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please provide the molecular formula for <molecule_2d> .", "role": "user" }, { "content": "C13H22BrN", "role": "assistant" } ]
124	{ "selfies": "[O][C][C][=C][C][=C][C][=C][C][=C][C][=C][C][Ring1][=Branch1][=C][C][=C][C][=C][C][Ring1][=Branch1][=C][Ring1][=C][C][=C][Ring2][Ring1][C][C][Ring2][Ring1][=Branch1][O]", "smiles": "OC1C=Cc2cc3c4ccccc4c4ccccc4c3cc2C1O" }	C22H16O2	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "I'd like to know the molecular formula of <molecule_2d> . Can you tell me?", "role": "user" }, { "content": "C22H16O2", "role": "assistant" } ]
126	{ "selfies": "[C][C][Branch1][C][C][C][Branch2][Ring1][=C][C][=Branch1][C][=O][O][C][Branch1][Ring1][C][#N][C][=C][C][=C][C][Branch1][#Branch2][O][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][Ring1][=N][C][=C][C][=C][Branch1][#Branch1][O][C][Branch1][C][F][F][C][=C][Ring1][#Branch2]", "smiles": "CC(C)C(C(=O)OC(C#N)c1cccc(Oc2ccccc2)c1)c1ccc(OC(F)F)cc1" }	C26H23F2NO4	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Can you tell me the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C26H23F2NO4", "role": "assistant" } ]
127	{ "selfies": "[C][O][C][=C][C][=C][C][Branch1][#Branch2][C][N+1][Branch1][C][C][Branch1][C][C][C][=C][Ring1][O]", "smiles": "COc1cccc(C[N+](C)(C)C)c1" }	C11H18NO+	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Can you give the molecular molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C11H18NO+", "role": "assistant" } ]
128	{ "selfies": "[C][=C][C][=C][C][Branch1][C][Cl][=C][Branch1][C][Cl][C][Branch1][C][Cl][=C][Ring1][=Branch2][Cl]", "smiles": "C=Cc1cc(Cl)c(Cl)c(Cl)c1Cl" }	C8H4Cl4	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "I'd like to know the molecular formula of <molecule_2d> . Can you tell me?", "role": "user" }, { "content": "C8H4Cl4", "role": "assistant" } ]
130	{ "selfies": "[C][O][C][=C][C][Branch1][Ring2][C][=N][O][=C][C][Branch1][C][I][=C][Ring1][#Branch2][O]", "smiles": "COc1cc(C=NO)cc(I)c1O" }	C8H8INO3	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please write the molecular formula of the molecule <molecule_2d> .", "role": "user" }, { "content": "C8H8INO3", "role": "assistant" } ]
131	{ "selfies": "[C][C][Branch2][Ring1][Ring2][C][C][=C][C][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][#Branch2][N][C][C][O][C][=Branch1][C][=O][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1]", "smiles": "CC(Cc1cccc(C(F)(F)F)c1)NCCOC(=O)CCc1ccccc1" }	C21H24F3NO2	[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Given the representation <molecule_2d>, what would be its molecular formula?", "role": "user" }, { "content": "C21H24F3NO2", "role": "assistant" } ]

0

{ "selfies": "[C][C][N][Branch1][Ring1][C][C][C][C][C][C][Branch1][C][C][N][C][=C][C][=C][C][Branch1][C][Cl][=C][C][Ring1][#Branch1][=N][C][=C][C][=C][Branch1][Ring1][O][C][C][=C][Ring1][P][Ring1][Branch2]", "smiles": "CCN(CC)CCCC(C)Nc1c2ccc(Cl)cc2nc2ccc(OC)cc12" }

C23H30ClN3O

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Can you tell me the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C23H30ClN3O", "role": "assistant" } ]

1

{ "selfies": "[N][O][C][C][=Branch1][C][=O][O]", "smiles": "NOCC(=O)O" }

C2H5NO3

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please provide the molecular formula for <molecule_2d> .", "role": "user" }, { "content": "C2H5NO3", "role": "assistant" } ]

2

{ "selfies": "[C][N][C][C][C][C][Ring1][Branch1][C][=C][C][=C][N+1][Branch1][C][C][=C][Ring1][#Branch1]", "smiles": "CN1CCCC1c1ccc[n+](C)c1" }

C11H17N2+

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "<molecule_2d> is the representation of a molecule. What is its molecular formula?", "role": "user" }, { "content": "C11H17N2+", "role": "assistant" } ]

3

{ "selfies": "[C][C][Branch1][C][C][=C][C][C][C][Branch1][C][C][=C][C][C][C][Branch1][C][C][=C][C][C][C][Branch1][C][C][=C][C][C][C][Branch1][C][C][=C][C][C][C][Branch1][C][C][=C][C][C][C][Branch1][C][C][=C][C][C][C][Branch1][C][C][=C][C][O]", "smiles": "CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCO" }

C40H66O

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Can you tell me the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C40H66O", "role": "assistant" } ]

4

{ "selfies": "[C][C][C][C][C][C][C][C][C][C][C][C][Branch1][C][O][C][C][=Branch1][C][=O][O][C][C][Branch1][C][N][C][Branch2][Ring2][N][O][P][=Branch1][C][=O][Branch1][C][O][O][P][=Branch1][C][=O][Branch1][C][O][O][C][C][O][C][Branch1][=N][N][C][=C][C][=Branch1][C][=O][NH1][C][Ring1][#Branch1][=O][C][Branch1][C][O][C][Ring1][=C][O][O][C][Branch1][Ring1][C][O][C][Ring2][Ring2][C][O]", "smiles": "CCCCCCCCCCCC(O)CC(=O)OC1C(N)C(OP(=O)(O)OP(=O)(O)OCC2OC(n3ccc(=O)[nH]c3=O)C(O)C2O)OC(CO)C1O" }

C29H51N3O18P2

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the formula of the molecule <molecule_2d> ?", "role": "user" }, { "content": "C29H51N3O18P2", "role": "assistant" } ]

5

{ "selfies": "[C][C][N][Branch1][Ring1][C][C][C][C][C][C][N][C][=N][C][=C][C][=C][Branch1][P][C][=C][C][Branch1][Ring1][O][C][=C][C][Branch1][Ring1][O][C][=C][Ring1][#Branch2][C][Branch1][#C][N][C][=Branch1][C][=O][N][C][Branch1][C][C][Branch1][C][C][C][=N][C][Ring2][Ring1][Branch2][=N][Ring2][Ring1][N]", "smiles": "CCN(CC)CCCCNc1ncc2cc(-c3cc(OC)cc(OC)c3)c(NC(=O)NC(C)(C)C)nc2n1" }

C28H41N7O3

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C28H41N7O3", "role": "assistant" } ]

6

{ "selfies": "[C][C][=C][C][=C][C][=C][Ring1][=Branch1][N][C][Branch1][Ring1][C][F][=N][C][=C][C][=C][Branch1][C][N][C][=C][Ring1][#Branch1][C][Ring1][=N][=O]", "smiles": "Cc1ccccc1-n1c(CF)nc2ccc(N)cc2c1=O" }

C16H14FN3O

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please provide the molecular formula for <molecule_2d> .", "role": "user" }, { "content": "C16H14FN3O", "role": "assistant" } ]

7

{ "selfies": "[C][C][=C][Branch1][C][C][C][=C][C][=C][Branch1][C][C][C][=C][C][=C][Branch1][C][C][C][C][C][C][Ring1][#Branch1][Branch1][C][C][C]", "smiles": "CC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C" }

C20H30

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please write the molecular formula of the molecule <molecule_2d> .", "role": "user" }, { "content": "C20H30", "role": "assistant" } ]

8

{ "selfies": "[C][O][C][=Branch1][C][=O][C][C][S][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][N][Ring2][Ring1][Ring1][Ring1][S]", "smiles": "COC(=O)C1CSC2(c3ccccc3)c3ccccc3C(=O)N12" }

C18H15NO3S

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "<molecule_2d> is the representation of a molecule. What is its molecular formula?", "role": "user" }, { "content": "C18H15NO3S", "role": "assistant" } ]

9

{ "selfies": "[C][C][C][Branch1][C][C][C][N][C][=Branch1][C][=O][C][Branch2][Ring1][C][C][=C][N][Branch1][Ring1][O][C][C][=C][C][=C][C][=C][Ring1][O][Ring1][=Branch1][N][C][=Branch1][C][=O][C][Branch1][N][C][C][C][C][C][C][=Branch1][C][=O][O][C][N][C][=Branch1][C][=O][C][C][C][C][C][N][Ring1][=Branch1][C][Ring2][Ring2][#Branch1][=O]", "smiles": "CCC(C)C1NC(=O)C(c2cn(OC)c3ccccc23)NC(=O)C(CCCCCC(=O)OC)NC(=O)C2CCCCN2C1=O" }

C32H45N5O7

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Considering the code <molecule_2d>, can you determine the corresponding molecular formula?", "role": "user" }, { "content": "C32H45N5O7", "role": "assistant" } ]

10

{ "selfies": "[O][=C][Branch1][N][N][N][C][S][=Branch1][C][=O][=Branch1][C][=O][O][C][=C][C][=N][C][=C][Ring1][=Branch1]", "smiles": "O=C(NNCS(=O)(=O)O)c1ccncc1" }

C7H9N3O4S

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula for the molecule denoted by <molecule_2d> ?", "role": "user" }, { "content": "C7H9N3O4S", "role": "assistant" } ]

11

{ "selfies": "[C][#C][C][O][S][=Branch1][C][=O][O][C][C][C][C][C][C][Ring1][=Branch1][O][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][C][=C][Ring1][#Branch2]", "smiles": "C#CCOS(=O)OC1CCCCC1Oc1ccc(C(C)(C)C)cc1" }

C19H26O4S

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the formula of the molecule <molecule_2d> ?", "role": "user" }, { "content": "C19H26O4S", "role": "assistant" } ]

12

{ "selfies": "[C][O][C][C][C][C][C][C][Branch1][C][C][C][Branch1][C][O][Branch1][Ring2][O][Ring1][Branch2][C][=Branch1][C][=O][C][=Branch1][C][=O][N][C][C][C][C][C][Ring1][=Branch1][C][=Branch1][C][=O][O][C][Branch2][Ring1][Branch1][C][Branch1][C][C][C][C][C][C][C][Branch1][C][O][C][Branch1][Ring1][O][C][C][Ring1][=Branch2][C][C][=Branch1][C][=O][C][Branch1][C][C][C][=C][Branch1][C][C][C][Branch1][C][O][C][Branch1][Ring1][O][C][C][=Branch1][C][=O][C][Branch1][C][C][C][C][Branch1][C][C][C][=C][C][=C][C][=C][Ring2][Branch1][=C][C]", "smiles": "COC1CC2CCC(C)C(O)(O2)C(=O)C(=O)N2CCCCC2C(=O)OC(C(C)CC2CCC(O)C(OC)C2)CC(=O)C(C)C=C(C)C(O)C(OC)C(=O)C(C)CC(C)C=CC=CC=C1C" }

C51H79NO13

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "I'd like to know the molecular formula of <molecule_2d> . Can you tell me?", "role": "user" }, { "content": "C51H79NO13", "role": "assistant" } ]

14

{ "selfies": "[O][=S][=Branch1][C][=O][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1]", "smiles": "O=S(=O)(c1ccccc1)c1ccc(Cl)cc1" }

C12H9ClO2S

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Convert the representation of a molecule <molecule_2d> into molecular formula.", "role": "user" }, { "content": "C12H9ClO2S", "role": "assistant" } ]

15

{ "selfies": "[C][=C][C][=C][Branch2][Ring1][C][C][=C][N][=C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][O][Ring1][O][C][=C][Ring1][P]", "smiles": "c1ccc(-c2cnc(-c3ccccc3)o2)cc1" }

C15H11NO

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "I'd like to know the molecular formula of <molecule_2d> . Can you tell me?", "role": "user" }, { "content": "C15H11NO", "role": "assistant" } ]

16

{ "selfies": "[C][C][=N][C][=C][C][=C][C][=C][Ring1][=Branch1][S][Ring1][=Branch2]", "smiles": "Cc1nc2ccccc2s1" }

C8H7NS

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Convert the representation of a molecule <molecule_2d> into molecular formula.", "role": "user" }, { "content": "C8H7NS", "role": "assistant" } ]

18

{ "selfies": "[C][O][P][=Branch1][C][=S][Branch1][Ring1][O][C][O][C]", "smiles": "COP(=S)(OC)OC" }

C3H9O3PS

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula for the molecule denoted by <molecule_2d> ?", "role": "user" }, { "content": "C3H9O3PS", "role": "assistant" } ]

19

{ "selfies": "[C][C][Branch1][C][C][N][=C][Branch1][C][N][N][=C][Branch1][C][N][N][Ring1][=Branch2][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1]", "smiles": "CC1(C)N=C(N)N=C(N)N1c1ccc(Cl)cc1" }

C11H14ClN5

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "<molecule_2d> is the representation of a molecule. What is its molecular formula?", "role": "user" }, { "content": "C11H14ClN5", "role": "assistant" } ]

20

{ "selfies": "[O][=C][=N][C][C][Branch1][C][F][Branch1][C][F][C][Branch1][C][F][Branch1][C][F][C][Branch1][C][F][Branch1][C][F][F]", "smiles": "O=C=NCC(F)(F)C(F)(F)C(F)(F)F" }

C5H2F7NO

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Convert the representation of a molecule <molecule_2d> into molecular formula.", "role": "user" }, { "content": "C5H2F7NO", "role": "assistant" } ]

22

{ "selfies": "[C][C][Branch1][C][C][C][S]", "smiles": "CC(C)CS" }

C4H10S

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula for the molecule denoted by <molecule_2d> ?", "role": "user" }, { "content": "C4H10S", "role": "assistant" } ]

23

{ "selfies": "[C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C]", "smiles": "CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC" }

C32H66

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula for the molecule denoted by <molecule_2d> ?", "role": "user" }, { "content": "C32H66", "role": "assistant" } ]

24

{ "selfies": "[C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring1][O]", "smiles": "c1ccc2c(c1)Cc1ccccc1C2" }

C14H12

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please write the molecular formula of the molecule <molecule_2d> .", "role": "user" }, { "content": "C14H12", "role": "assistant" } ]

25

{ "selfies": "[C][C][O][C][=Branch1][C][=O][N][Branch1][Ring1][C][C][N][=O]", "smiles": "CCOC(=O)N(CC)N=O" }

C5H10N2O3

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula for the molecule denoted by <molecule_2d> ?", "role": "user" }, { "content": "C5H10N2O3", "role": "assistant" } ]

26

{ "selfies": "[O][C][=C][C][=C][Branch1][C][Br][C][=C][Ring1][#Branch1][Br]", "smiles": "Oc1ccc(Br)cc1Br" }

C6H4Br2O

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "I'd like to know the molecular formula of <molecule_2d> . Can you tell me?", "role": "user" }, { "content": "C6H4Br2O", "role": "assistant" } ]

27

{ "selfies": "[O][=C][C][=C][NH1][C][=C][Ring1][=Branch1]", "smiles": "O=c1cc[nH]cc1" }

C5H5NO

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Given the representation <molecule_2d>, what would be its molecular formula?", "role": "user" }, { "content": "C5H5NO", "role": "assistant" } ]

28

{ "selfies": "[C][C][=C][C][Branch2][Ring1][Ring1][O][C][=C][Branch1][C][I][C][=C][Branch1][Ring2][C][C][O][C][=C][Ring1][#Branch2][I][=C][C][Branch1][C][C][=C][Ring2][Ring1][Ring1][O]", "smiles": "Cc1cc(Oc2c(I)cc(CCO)cc2I)cc(C)c1O" }

C16H16I2O3

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C16H16I2O3", "role": "assistant" } ]

29

{ "selfies": "[C][C][C][C][O][P][Branch1][Branch1][O][C][Ring1][=Branch1][O][C][Ring1][Branch2]", "smiles": "CCC12COP(OC1)OC2" }

C6H11O3P

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Can you tell me the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C6H11O3P", "role": "assistant" } ]

30

{ "selfies": "[C][C][C][C][C][C][C][C][Branch1][C][Cl][C][C]", "smiles": "CCCCCCCC(Cl)CC" }

C10H21Cl

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please write the molecular formula of the molecule <molecule_2d> .", "role": "user" }, { "content": "C10H21Cl", "role": "assistant" } ]

31

{ "selfies": "[C][N][Branch2][Ring1][Ring2][C][=Branch1][C][=S][O][C][=C][C][=C][C][=C][C][=C][C][Ring1][=Branch1][=C][Ring1][#Branch2][C][=C][C][=C][C][=C][C][=C][C][=C][Ring1][#Branch2][Ring1][=Branch1]", "smiles": "CN(C(=S)Oc1ccc2ccccc2c1)c1cccc2ccccc12" }

C22H17NOS

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Considering the code <molecule_2d>, can you determine the corresponding molecular formula?", "role": "user" }, { "content": "C22H17NOS", "role": "assistant" } ]

32

{ "selfies": "[C][C][C][=C][Branch1][S][C][=Branch1][C][=O][N][N][C][C][=C][C][=C][C][=C][Ring1][=Branch1][O][N][=Ring1][S]", "smiles": "Cc1cc(C(=O)NNCc2ccccc2)on1" }

C12H13N3O2

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Given the representation <molecule_2d>, what would be its molecular formula?", "role": "user" }, { "content": "C12H13N3O2", "role": "assistant" } ]

33

{ "selfies": "[C][Si][Branch1][C][Cl][Branch1][C][Cl][C][C][C][C][#N]", "smiles": "C[Si](Cl)(Cl)CCCC#N" }

C5H9Cl2NSi

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Can you tell me the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C5H9Cl2NSi", "role": "assistant" } ]

34

{ "selfies": "[C][=C][C][=C][Branch2][Ring1][=C][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][N][C][C][O][C][C][Ring1][=Branch1][C][=C][Ring2][Ring1][=Branch2]", "smiles": "c1ccc(C(c2ccccc2)(c2ccccc2)N2CCOCC2)cc1" }

C23H23NO

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "The representation <molecule_2d> represents a specific molecule. Can you reveal its molecular formula?", "role": "user" }, { "content": "C23H23NO", "role": "assistant" } ]

35

{ "selfies": "[C][=C][Branch1][Ring1][C][C][C][C][C][C]", "smiles": "C=C(CC)CCCC" }

C8H16

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C8H16", "role": "assistant" } ]

36

{ "selfies": "[C][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C]", "smiles": "C=CC(=O)OC(C)(C)C" }

C7H12O2

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula for the molecule denoted by <molecule_2d> ?", "role": "user" }, { "content": "C7H12O2", "role": "assistant" } ]

37

{ "selfies": "[N][C][=Branch1][C][=O][C][N][C][=Branch1][C][=O][N][Branch1][#Branch1][C][C][Branch1][C][N][=O][C][=Branch1][C][=O][N][Branch1][#Branch1][C][C][Branch1][C][N][=O][C][Ring1][S][=O]", "smiles": "NC(=O)Cn1c(=O)n(CC(N)=O)c(=O)n(CC(N)=O)c1=O" }

C9H12N6O6

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Convert the representation of a molecule <molecule_2d> into molecular formula.", "role": "user" }, { "content": "C9H12N6O6", "role": "assistant" } ]

38

{ "selfies": "[N][#C][C][=C][Branch1][C][Cl][C][Branch1][C][Cl][=C][Branch1][C][Cl][C][Branch1][Ring1][C][#N][=C][Ring1][O][Cl]", "smiles": "N#Cc1c(Cl)c(Cl)c(Cl)c(C#N)c1Cl" }

C8Cl4N2

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "<molecule_2d> is the representation of a molecule. What is its molecular formula?", "role": "user" }, { "content": "C8Cl4N2", "role": "assistant" } ]

39

{ "selfies": "[C][C][Branch1][Ring1][C][Cl][O][C][=Branch1][C][=O][N][C][=C][C][=C][C][Branch1][C][Cl][=C][Ring1][#Branch1]", "smiles": "CC(CCl)OC(=O)Nc1cccc(Cl)c1" }

C10H11Cl2NO2

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please provide the molecular formula for <molecule_2d> .", "role": "user" }, { "content": "C10H11Cl2NO2", "role": "assistant" } ]

40

{ "selfies": "[N][C][=Branch1][C][=O][N][Hg][C][=C][C][=C][C][=C][Ring1][=Branch1]", "smiles": "NC(=O)N[Hg]c1ccccc1" }

C7H8HgN2O

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Can you give the molecular molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C7H8HgN2O", "role": "assistant" } ]

45

{ "selfies": "[Cl][C][=C][C][=C][Branch2][Ring1][=C][C][=N][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][=N][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][=N][Ring2][Ring1][C][C][=C][Ring2][Ring1][Branch2]", "smiles": "Clc1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc1" }

C21H14ClN3

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Can you give the molecular molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C21H14ClN3", "role": "assistant" } ]

46

{ "selfies": "[N][C][Branch1][N][C][C][N][C][C][C][C][C][C][Ring1][#Branch1][=N][O]", "smiles": "NC(CCN1CCCCCC1)=NO" }

C9H19N3O

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula for the molecule denoted by <molecule_2d> ?", "role": "user" }, { "content": "C9H19N3O", "role": "assistant" } ]

47

{ "selfies": "[C][C][O][C][=C][C][=C][Branch2][Ring1][Branch2][O][C][=N][C][=C][C][=C][C][=C][Ring1][=Branch1][N][Ring1][=Branch2][C][C][N][Branch1][Ring1][C][C][C][C][C][=C][Ring2][Ring1][#Branch1]", "smiles": "CCOc1ccc(Oc2nc3ccccc3n2CCN(CC)CC)cc1" }

C21H27N3O2

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the formula of the molecule <molecule_2d> ?", "role": "user" }, { "content": "C21H27N3O2", "role": "assistant" } ]

49

{ "selfies": "[C][C][=Branch1][C][=O][O][C][=C][C][=C][C][=C][Ring1][=Branch1][Cl]", "smiles": "CC(=O)Oc1ccccc1Cl" }

C8H7ClO2

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please provide the molecular formula for <molecule_2d> .", "role": "user" }, { "content": "C8H7ClO2", "role": "assistant" } ]

50

{ "selfies": "[C][C][Branch2][Ring1][O][C][C][=C][NH1][C][=C][C][=C][Branch1][O][S][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring1][P][Ring1][=C][N][Branch1][C][C][C]", "smiles": "CC(Cc1c[nH]c2ccc(SCc3ccccc3)cc12)N(C)C" }

C20H24N2S

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please write the molecular formula of the molecule <molecule_2d> .", "role": "user" }, { "content": "C20H24N2S", "role": "assistant" } ]

51

{ "selfies": "[C][C][N][Branch1][Ring1][C][C][C][C][N][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Branch1][C][C][C]", "smiles": "CCN(CC)CCN(c1ccccc1)C(C)C" }

C15H26N2

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Convert the representation of a molecule <molecule_2d> into molecular formula.", "role": "user" }, { "content": "C15H26N2", "role": "assistant" } ]

52

{ "selfies": "[C][C][O][C][=Branch1][C][=O][N][Branch1][Ring2][C][C][Cl][N][=O]", "smiles": "CCOC(=O)N(CCCl)N=O" }

C5H9ClN2O3

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Given the representation <molecule_2d>, what would be its molecular formula?", "role": "user" }, { "content": "C5H9ClN2O3", "role": "assistant" } ]

53

{ "selfies": "[Cl][Fe][Cl]", "smiles": "Cl[Fe]Cl" }

Cl2Fe

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the formula of the molecule <molecule_2d> ?", "role": "user" }, { "content": "Cl2Fe", "role": "assistant" } ]

54

{ "selfies": "[C][O][C][=Branch1][C][=O][N][C][=C][C][=C][C][Branch2][Ring1][C][O][C][=Branch1][C][=O][N][C][=C][C][=C][C][Branch1][C][C][=C][Ring1][#Branch1][=C][Ring1][P]", "smiles": "COC(=O)Nc1cccc(OC(=O)Nc2cccc(C)c2)c1" }

C16H16N2O4

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C16H16N2O4", "role": "assistant" } ]

56

{ "selfies": "[O][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][C][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][Ring1][=N][C][=C][C][=C][Branch1][N][O][C][C][N][C][C][C][C][C][Ring1][=Branch1][C][=C][Ring1][#C]", "smiles": "Oc1ccc2c(c1)CCC(c1ccccc1)=C2c1ccc(OCCN2CCCCC2)cc1" }

C29H31NO2

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C29H31NO2", "role": "assistant" } ]

57

{ "selfies": "[C][C][=Branch1][C][=O][C][=C][C][=C][Branch2][Ring1][Branch1][N][C][O][C][Branch1][Ring1][C][O][C][Branch1][C][O][C][Branch1][C][O][C][Ring1][#Branch2][O][C][=C][Ring2][Ring1][C]", "smiles": "CC(=O)c1ccc(NC2OC(CO)C(O)C(O)C2O)cc1" }

C14H19NO6

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C14H19NO6", "role": "assistant" } ]

58

{ "selfies": "[N][#C][C][Branch1][Ring1][C][#N][=C][C][#C][C][=C][C][=C][C][=C][Ring1][=Branch1]", "smiles": "N#CC(C#N)=CC#Cc1ccccc1" }

C12H6N2

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please write the molecular formula of the molecule <molecule_2d> .", "role": "user" }, { "content": "C12H6N2", "role": "assistant" } ]

60

{ "selfies": "[C][=C][C][C][=C][C][=C][Branch1][Branch2][O][C][=Branch1][C][=O][N][C][C][Branch1][Ring1][O][C][=C][Ring1][=N]", "smiles": "C=CCc1ccc(OC(=O)NC)c(OC)c1" }

C12H15NO3

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C12H15NO3", "role": "assistant" } ]

61

{ "selfies": "[C][O][C][=C][C][Branch1][C][N][=C][C][=C][Ring1][#Branch1][O][C][C][C][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1]", "smiles": "COc1cc(N)ccc1OCCCCCc1ccccc1" }

C18H23NO2

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please write the molecular formula of the molecule <molecule_2d> .", "role": "user" }, { "content": "C18H23NO2", "role": "assistant" } ]

62

{ "selfies": "[C][C][Branch1][C][C][C][=Branch1][C][=O][O][C][C][Branch1][C][C][Branch1][C][C][C][Branch2][Ring1][N][O][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Branch1][C][C][C]", "smiles": "CC(C)C(=O)OCC(C)(C)C(OC(=O)c1ccccc1C(=O)OCc1ccccc1)C(C)C" }

C27H34O6

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Can you tell me the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C27H34O6", "role": "assistant" } ]

64

{ "selfies": "[C][C][O][C][C][=C][Branch1][C][O][C][=C][C][=Branch1][Branch1][=C][Ring1][#Branch1][O][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring1][=N][=O]", "smiles": "CCOCc1c(O)cc2c(c1O)C(=O)c1ccccc1C2=O" }

C17H14O5

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Convert the representation of a molecule <molecule_2d> into molecular formula.", "role": "user" }, { "content": "C17H14O5", "role": "assistant" } ]

65

{ "selfies": "[C][O][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][O][C][Branch1][C][C][Branch1][C][C][C][=C][Ring1][=Branch2]", "smiles": "COc1ccc2c(c1)OC(C)(C)C=C2" }

C12H14O2

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the formula of the molecule <molecule_2d> ?", "role": "user" }, { "content": "C12H14O2", "role": "assistant" } ]

66

{ "selfies": "[C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][=Branch1][C][=O][O][C][C]", "smiles": "CCCCCCCCCCCCCCCCCCCC(=O)OCC" }

C22H44O2

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Given the representation <molecule_2d>, what would be its molecular formula?", "role": "user" }, { "content": "C22H44O2", "role": "assistant" } ]

68

{ "selfies": "[C][C][C][C][C][O][C][Branch1][=Branch1][C][Branch1][C][C][C][O][C][Ring1][=Branch2]", "smiles": "CCCC1COC(C(C)C)OC1" }

C10H20O2

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please provide the molecular formula for <molecule_2d> .", "role": "user" }, { "content": "C10H20O2", "role": "assistant" } ]

69

{ "selfies": "[C][S][=Branch1][C][=O][=Branch1][C][=O][O][C][C][O]", "smiles": "CS(=O)(=O)OCCO" }

C3H8O4S

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "The representation <molecule_2d> represents a specific molecule. Can you reveal its molecular formula?", "role": "user" }, { "content": "C3H8O4S", "role": "assistant" } ]

70

{ "selfies": "[C][C][O][C][=Branch1][C][=O][C][Branch1][C][C][Branch1][Branch1][C][C][O][C][C][=Branch1][C][=O][O][C][C]", "smiles": "CCOC(=O)C(C)(CCOC)C(=O)OCC" }

C11H20O5

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please provide the molecular formula for <molecule_2d> .", "role": "user" }, { "content": "C11H20O5", "role": "assistant" } ]

72

{ "selfies": "[C][C][S][C][C][Branch1][C][N][C][=Branch1][C][=O][O]", "smiles": "CCSCC(N)C(=O)O" }

C5H11NO2S

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Can you tell me the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C5H11NO2S", "role": "assistant" } ]

73

{ "selfies": "[C][C][C][C][C][C][C][C][C][=O]", "smiles": "CCCCCCCCC=O" }

C9H18O

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "The representation <molecule_2d> represents a specific molecule. Can you reveal its molecular formula?", "role": "user" }, { "content": "C9H18O", "role": "assistant" } ]

78

{ "selfies": "[C][O][C][=C][C][=C][C][=C][Ring1][=Branch1][N][C][C][N][Branch2][Ring1][N][C][=Branch1][C][=O][C][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][C][Ring2][Ring1][#Branch1]", "smiles": "COc1ccccc1N1CCN(C(=O)CC(c2ccccc2)c2ccc(Cl)cc2)CC1" }

C26H27ClN2O2

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the formula of the molecule <molecule_2d> ?", "role": "user" }, { "content": "C26H27ClN2O2", "role": "assistant" } ]

79

{ "selfies": "[C][N][C][=C][C][=C][C][=C][Branch1][Ring1][O][C][C][Branch1][Ring1][O][C][=C][C][=C][Ring1][=C][Ring1][#Branch2]", "smiles": "CNc1cccc2c(OC)c(OC)ccc12" }

C13H15NO2

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Can you give the molecular molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C13H15NO2", "role": "assistant" } ]

80

{ "selfies": "[C][C][C][C][As][Branch1][#Branch2][S][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1]", "smiles": "CCCC[As](Sc1ccccc1)c1ccccc1" }

C16H19AsS

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please write the molecular formula of the molecule <molecule_2d> .", "role": "user" }, { "content": "C16H19AsS", "role": "assistant" } ]

81

{ "selfies": "[C][C][C][N][Branch1][Ring2][C][C][C][C][=N][C][Branch1][=Branch2][C][Branch1][C][Cl][Branch1][C][Cl][Cl][=N][C][Branch1][=Branch2][C][Branch1][C][Cl][Branch1][C][Cl][Cl][=N][Ring1][=C]", "smiles": "CCCN(CCC)c1nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n1" }

C11H14Cl6N4

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please write the molecular formula of the molecule <molecule_2d> .", "role": "user" }, { "content": "C11H14Cl6N4", "role": "assistant" } ]

82

{ "selfies": "[C][C][C][C][C][=Branch1][C][=O][C][=C][Branch1][C][C][O][C]", "smiles": "CCCCC(=O)C=C(C)OC" }

C9H16O2

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Considering the code <molecule_2d>, can you determine the corresponding molecular formula?", "role": "user" }, { "content": "C9H16O2", "role": "assistant" } ]

83

{ "selfies": "[C][C][N][Branch1][Ring1][C][C][C][=Branch1][C][=O][C][C][Branch1][C][O][C][Branch1][C][Cl][Branch1][C][Cl][Cl]", "smiles": "CCN(CC)C(=O)CC(O)C(Cl)(Cl)Cl" }

C8H14Cl3NO2

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the formula of the molecule <molecule_2d> ?", "role": "user" }, { "content": "C8H14Cl3NO2", "role": "assistant" } ]

85

{ "selfies": "[N-1][=N+1][=C][C][=N][C][Branch1][C][N][=N][C][Branch1][C][N][=N][Ring1][Branch2]", "smiles": "[N-]=[N+]=Cc1nc(N)nc(N)n1" }

C4H5N7

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please write the molecular formula of the molecule <molecule_2d> .", "role": "user" }, { "content": "C4H5N7", "role": "assistant" } ]

86

{ "selfies": "[C][S][C][Branch1][Ring1][S][C][C][=N][C][Branch1][C][C][=N][C][Branch1][=Branch1][C][Branch1][C][Cl][Cl][=N][Ring1][#Branch2]", "smiles": "CSC(SC)c1nc(C)nc(C(Cl)Cl)n1" }

C8H11Cl2N3S2

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "<molecule_2d> is the representation of a molecule. What is its molecular formula?", "role": "user" }, { "content": "C8H11Cl2N3S2", "role": "assistant" } ]

87

{ "selfies": "[O][=C][Branch1][O][C][=C][C][=C][C][=C][C][=C][Ring1][=Branch1][N][C][C][Cl]", "smiles": "O=C(C=Cc1ccccc1)NCCCl" }

C11H12ClNO

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Convert the representation of a molecule <molecule_2d> into molecular formula.", "role": "user" }, { "content": "C11H12ClNO", "role": "assistant" } ]

88

{ "selfies": "[C][C][C][C][O][C][=N][C][Branch1][C][C][=N][C][Branch1][=Branch2][C][Branch1][C][Cl][Branch1][C][Cl][Cl][=N][Ring1][O]", "smiles": "CCCCOc1nc(C)nc(C(Cl)(Cl)Cl)n1" }

C9H12Cl3N3O

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Can you give the molecular molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C9H12Cl3N3O", "role": "assistant" } ]

91

{ "selfies": "[C][=C][Branch1][C][C][C][N][C][C][C][=C][Branch1][C][C][NH1][C][=C][C][=C][Branch1][Ring1][O][C][C][Branch1][C][C][=C][Ring1][=N][Ring1][=Branch2]", "smiles": "C=C(C)CNCCc1c(C)[nH]c2ccc(OC)c(C)c12" }

C17H24N2O

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula for the molecule denoted by <molecule_2d> ?", "role": "user" }, { "content": "C17H24N2O", "role": "assistant" } ]

93

{ "selfies": "[C][O][C][=C][C][Branch1][=C][C][=C][C][=Branch1][C][=O][N][C][C][C][O][Ring1][Branch1][=C][C][Branch1][Ring1][O][C][=C][Ring1][P][O][C]", "smiles": "COc1cc(C=CC(=O)N2CCCO2)cc(OC)c1OC" }

C15H19NO5

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please provide the molecular formula for <molecule_2d> .", "role": "user" }, { "content": "C15H19NO5", "role": "assistant" } ]

94

{ "selfies": "[C][C][=C][C][Branch1][=Branch1][N][Branch1][C][C][C][=C][N][=C][N][=C][Ring1][Branch1][C][N][=C][Branch1][C][N][N][Branch1][C][C][C][Ring2][Ring1][C][=Ring1][#Branch1]", "smiles": "Cc1cc(N(C)C)c2ncnc-2c2nc(N)n(C)c12" }

C13H16N6

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C13H16N6", "role": "assistant" } ]

96

{ "selfies": "[O][=C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][N][Branch1][C][O][C][N][C][C][O][C][C][Ring1][=Branch1]", "smiles": "O=C(c1ccccc1)N(O)CN1CCOCC1" }

C12H16N2O3

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the formula of the molecule <molecule_2d> ?", "role": "user" }, { "content": "C12H16N2O3", "role": "assistant" } ]

97

{ "selfies": "[C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][N][Branch1][C][C][C][Branch1][C][C][C][Ring1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1]", "smiles": "Cc1cccc2c1C(=O)N(C)C(C)C2c1ccccc1" }

C18H19NO

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula for the molecule denoted by <molecule_2d> ?", "role": "user" }, { "content": "C18H19NO", "role": "assistant" } ]

98

{ "selfies": "[C][C][C][Branch1][C][C][C][O][C][=Branch1][C][=O][C][Ring1][#Branch1]", "smiles": "CCC1(C)COC(=O)C1" }

C7H12O2

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please provide the molecular formula for <molecule_2d> .", "role": "user" }, { "content": "C7H12O2", "role": "assistant" } ]

100

{ "selfies": "[C][C][O][C][=Branch1][C][=O][C][Branch1][#Branch2][C][N][C][C][C][C][C][Ring1][=Branch1][Branch1][Branch2][C][=Branch1][C][=O][O][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1]", "smiles": "CCOC(=O)C(CN1CCCCC1)(C(=O)OCC)c1ccccc1" }

C19H27NO4

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Can you give the molecular molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C19H27NO4", "role": "assistant" } ]

102

{ "selfies": "[C][C][Branch1][Ring1][C][=O][=C][C][Branch1][C][C][Branch1][C][C][C]", "smiles": "CC(C=O)=CC(C)(C)C" }

C8H14O

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Convert the representation of a molecule <molecule_2d> into molecular formula.", "role": "user" }, { "content": "C8H14O", "role": "assistant" } ]

104

{ "selfies": "[C][N][Branch1][#Branch2][S][N][C][C][O][C][C][Ring1][=Branch1][C][=Branch1][C][=O][O][C][=C][C][=C][C][=C][Ring1][=Branch1][O][C][Branch1][C][C][Branch1][C][C][C][Ring1][#Branch1]", "smiles": "CN(SN1CCOCC1)C(=O)Oc1cccc2c1OC(C)(C)C2" }

C16H22N2O4S

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "<molecule_2d> is the representation of a molecule. What is its molecular formula?", "role": "user" }, { "content": "C16H22N2O4S", "role": "assistant" } ]

105

{ "selfies": "[C][C][O][C][=Branch1][C][=O][C][=C][Branch1][C][C][C][=C][C][Branch1][Ring1][C][O][=N][NH1][C][=Branch1][C][=O][C][Ring1][=Branch2][=C][Ring1][=C][C]", "smiles": "CCOC(=O)c1c(C)cc2c(CO)n[nH]c(=O)c2c1C" }

C14H16N2O4

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please write the molecular formula of the molecule <molecule_2d> .", "role": "user" }, { "content": "C14H16N2O4", "role": "assistant" } ]

106

{ "selfies": "[C][C][Branch1][C][C][C][=Branch1][C][=O][C][C][C][C][C][=Branch1][C][=O][C][C][C][Ring1][#Branch1][Ring1][=N][C]", "smiles": "CC1(C)C(=O)CCC2CC(=O)CCC21C" }

C13H20O2

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Can you give the molecular molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C13H20O2", "role": "assistant" } ]

107

{ "selfies": "[C][#C][C][O][C][Branch1][C][C][N][C][=C][C][=C][C][=C][C][=C][Ring1][=Branch1][Ring1][=Branch2]", "smiles": "C#CCOC(C)n1ccc2ccccc21" }

C13H13NO

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "<molecule_2d> is the representation of a molecule. What is its molecular formula?", "role": "user" }, { "content": "C13H13NO", "role": "assistant" } ]

108

{ "selfies": "[C][C][=C][C][=C][C][Branch1][N][O][C][=Branch1][C][=O][N][Branch1][C][C][N][=O][=C][Ring1][=N]", "smiles": "Cc1cccc(OC(=O)N(C)N=O)c1" }

C9H10N2O3

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "The representation <molecule_2d> represents a specific molecule. Can you reveal its molecular formula?", "role": "user" }, { "content": "C9H10N2O3", "role": "assistant" } ]

109

{ "selfies": "[C][O][C][=C][C][=C][Branch1][=N][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Branch1][Ring1][O][C][=C][Ring1][S][C][N][C][C][C][C][C][Ring1][=Branch1]", "smiles": "COc1ccc(C(=O)c2ccccc2)c(OC)c1CN1CCCCC1" }

C21H25NO3

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Given the representation <molecule_2d>, what would be its molecular formula?", "role": "user" }, { "content": "C21H25NO3", "role": "assistant" } ]

111

{ "selfies": "[C][C][Branch1][C][C][N][C][C][=Branch1][C][=O][N][C][C][=Branch1][C][=O][N][Branch1][C][C][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][Cl]", "smiles": "CC(C)NCC(=O)NCC(=O)N(C)c1ccc(Cl)cc1C(=O)c1ccccc1Cl" }

C21H23Cl2N3O3

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula for the molecule denoted by <molecule_2d> ?", "role": "user" }, { "content": "C21H23Cl2N3O3", "role": "assistant" } ]

112

{ "selfies": "[C][N][C][C][N][Branch2][Ring1][Branch1][C][=C][Branch1][C][N][C][=Branch1][C][=O][O][C][=C][C][=C][C][=C][Ring1][N][Ring1][=Branch1][C][C][Ring2][Ring1][C]", "smiles": "CN1CCN(c2c(N)c(=O)oc3ccccc23)CC1" }

C14H17N3O2

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Convert the representation of a molecule <molecule_2d> into molecular formula.", "role": "user" }, { "content": "C14H17N3O2", "role": "assistant" } ]

113

{ "selfies": "[O][=C][Branch1][C][O][C][Branch1][C][Cl][Branch1][C][Cl][C][=C][C][=C][C][=C][Ring1][=Branch1]", "smiles": "O=C(O)C(Cl)(Cl)c1ccccc1" }

C8H6Cl2O2

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Can you tell me the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C8H6Cl2O2", "role": "assistant" } ]

114

{ "selfies": "[O][C][=C][C][=C][C][Branch1][C][F][=C][Ring1][#Branch1][C][=N][C][C][N][=C][C][=C][Branch1][C][O][C][=C][C][=C][Ring1][#Branch1][F]", "smiles": "Oc1cccc(F)c1C=NCCN=Cc1c(O)cccc1F" }

C16H14F2N2O2

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C16H14F2N2O2", "role": "assistant" } ]

115

{ "selfies": "[O][=C][Branch1][#Branch2][N][N][=C][S][C][C][S][Ring1][Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1]", "smiles": "O=C(NN=C1SCCS1)c1ccccc1" }

C10H10N2OS2

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please write the molecular formula of the molecule <molecule_2d> .", "role": "user" }, { "content": "C10H10N2OS2", "role": "assistant" } ]

119

{ "selfies": "[C][C][C][C][C][C][O][C][=C][C][=C][Branch2][Ring1][Ring1][N][C][=Branch1][C][=O][O][C][Branch1][C][C][C][N][Branch1][Ring1][C][C][C][C][C][Branch1][C][C][=C][Ring2][Ring1][Ring1]", "smiles": "CCCCCCOc1ccc(NC(=O)OC(C)CN(CC)CC)c(C)c1" }

C21H36N2O3

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Given the representation <molecule_2d>, what would be its molecular formula?", "role": "user" }, { "content": "C21H36N2O3", "role": "assistant" } ]

120

{ "selfies": "[C][N][Branch1][C][C][C][=Branch1][C][=O][O][C][=C][C][=C][Branch1][O][N+1][Branch1][C][C][Branch1][C][C][C][C][O][C][=C][Ring1][N]", "smiles": "CN(C)C(=O)Oc1ccc([N+](C)(C)CCO)cc1" }

C13H21N2O3+

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Can you tell me the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C13H21N2O3+", "role": "assistant" } ]

122

{ "selfies": "[C][C][=Branch1][C][=O][N][Branch1][=Branch1][C][Branch1][C][C][=O][C][Branch1][C][C][Branch1][C][C][C]", "smiles": "CC(=O)N(C(C)=O)C(C)(C)C" }

C8H15NO2

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "What is the molecular formula for the molecule denoted by <molecule_2d> ?", "role": "user" }, { "content": "C8H15NO2", "role": "assistant" } ]

123

{ "selfies": "[C][N][Branch1][C][C][C][C][C][C][C][C][Branch1][N][C][C][Branch1][Ring2][C][Ring1][=Branch1][C][Ring1][=Branch2][Br][C][Ring1][O]", "smiles": "CN(C)CC12CC3CC(CC(C3)C1Br)C2" }

C13H22BrN

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please provide the molecular formula for <molecule_2d> .", "role": "user" }, { "content": "C13H22BrN", "role": "assistant" } ]

124

{ "selfies": "[O][C][C][=C][C][=C][C][=C][C][=C][C][=C][C][Ring1][=Branch1][=C][C][=C][C][=C][C][Ring1][=Branch1][=C][Ring1][=C][C][=C][Ring2][Ring1][C][C][Ring2][Ring1][=Branch1][O]", "smiles": "OC1C=Cc2cc3c4ccccc4c4ccccc4c3cc2C1O" }

C22H16O2

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "I'd like to know the molecular formula of <molecule_2d> . Can you tell me?", "role": "user" }, { "content": "C22H16O2", "role": "assistant" } ]

126

{ "selfies": "[C][C][Branch1][C][C][C][Branch2][Ring1][=C][C][=Branch1][C][=O][O][C][Branch1][Ring1][C][#N][C][=C][C][=C][C][Branch1][#Branch2][O][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][Ring1][=N][C][=C][C][=C][Branch1][#Branch1][O][C][Branch1][C][F][F][C][=C][Ring1][#Branch2]", "smiles": "CC(C)C(C(=O)OC(C#N)c1cccc(Oc2ccccc2)c1)c1ccc(OC(F)F)cc1" }

C26H23F2NO4

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Can you tell me the molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C26H23F2NO4", "role": "assistant" } ]

127

{ "selfies": "[C][O][C][=C][C][=C][C][Branch1][#Branch2][C][N+1][Branch1][C][C][Branch1][C][C][C][=C][Ring1][O]", "smiles": "COc1cccc(C[N+](C)(C)C)c1" }

C11H18NO+

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Can you give the molecular molecular formula of <molecule_2d> ?", "role": "user" }, { "content": "C11H18NO+", "role": "assistant" } ]

128

{ "selfies": "[C][=C][C][=C][C][Branch1][C][Cl][=C][Branch1][C][Cl][C][Branch1][C][Cl][=C][Ring1][=Branch2][Cl]", "smiles": "C=Cc1cc(Cl)c(Cl)c(Cl)c1Cl" }

C8H4Cl4

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "I'd like to know the molecular formula of <molecule_2d> . Can you tell me?", "role": "user" }, { "content": "C8H4Cl4", "role": "assistant" } ]

130

{ "selfies": "[C][O][C][=C][C][Branch1][Ring2][C][=N][O][=C][C][Branch1][C][I][=C][Ring1][#Branch2][O]", "smiles": "COc1cc(C=NO)cc(I)c1O" }

C8H8INO3

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Please write the molecular formula of the molecule <molecule_2d> .", "role": "user" }, { "content": "C8H8INO3", "role": "assistant" } ]

131

{ "selfies": "[C][C][Branch2][Ring1][Ring2][C][C][=C][C][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][#Branch2][N][C][C][O][C][=Branch1][C][=O][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1]", "smiles": "CC(Cc1cccc(C(F)(F)F)c1)NCCOC(=O)CCc1ccccc1" }

C21H24F3NO2

[ { "content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.", "role": "system" }, { "content": "Given the representation <molecule_2d>, what would be its molecular formula?", "role": "user" }, { "content": "C21H24F3NO2", "role": "assistant" } ]

Datasets:

OpenMol
/

SMol_S2F_270K-MMChat

Collection including OpenMol/SMol_S2F_270K-MMChat

MMChat SFT